C25H29N2NaO4 — CID 173223137
sodium;hydride;2-[[4-[2-(quinoline-3-carbonylamino)ethoxy]phenyl]methyl]hexanoic acid (PubChem CID 173223137) has the molecular formula C25H29N2NaO4 and a molecular weight of 444.51 g/mol. Its IUPAC name is sodium;hydride;2-[[4-[2-(quinoline-3-carbonylamino)ethoxy]phenyl]methyl]hexanoic acid.
| Compound Name | sodium;hydride;2-[[4-[2-(quinoline-3-carbonylamino)ethoxy]phenyl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 173223137 |
| Molecular Formula | C25H29N2NaO4 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | sodium;hydride;2-[[4-[2-(quinoline-3-carbonylamino)ethoxy]phenyl]methyl]hexanoic acid |
| SMILES | CCCCC(Cc1ccc(OCCNC(=O)c2cnc3ccccc3c2)cc1)C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C25H28N2O4.Na.H/c1-2-3-6-20(25(29)30)15-18-9-11-22(12-10-18)31-14-13-26-24(28)21-16-19-7-4-5-8-23(19)27-17-21;;/h4-5,7-12,16-17,20H,2-3,6,13-15H2,1H3,(H,26,28)(H,29,30);;/q;+1;-1 |
| InChIKey | VPSRGZNKLOLMEV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|