C29H34N2O5 — CID 18625705
ethyl 2-[[4-[2-[(6-phenoxypyridine-3-carbonyl)amino]ethoxy]phenyl]methyl]hexanoate (PubChem CID 18625705) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is ethyl 2-[[4-[2-[(6-phenoxypyridine-3-carbonyl)amino]ethoxy]phenyl]methyl]hexanoate.
| Compound Name | ethyl 2-[[4-[2-[(6-phenoxypyridine-3-carbonyl)amino]ethoxy]phenyl]methyl]hexanoate |
|---|---|
| PubChem CID | 18625705 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | ethyl 2-[[4-[2-[(6-phenoxypyridine-3-carbonyl)amino]ethoxy]phenyl]methyl]hexanoate |
| SMILES | CCCCC(Cc1ccc(OCCNC(=O)c2ccc(Oc3ccccc3)nc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C29H34N2O5/c1-3-5-9-23(29(33)34-4-2)20-22-12-15-25(16-13-22)35-19-18-30-28(32)24-14-17-27(31-21-24)36-26-10-7-6-8-11-26/h6-8,10-17,21,23H,3-5,9,18-20H2,1-2H3,(H,30,32) |
| InChIKey | SQLVHTPABHDUJT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|