C23H28O6 — CID 69418001
ethyl (2R)-2-ethoxy-3-[4-[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxyphenyl]propanoate (PubChem CID 69418001) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is ethyl (2R)-2-ethoxy-3-[4-[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxyphenyl]propanoate.
| Compound Name | ethyl (2R)-2-ethoxy-3-[4-[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxyphenyl]propanoate |
|---|---|
| PubChem CID | 69418001 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl (2R)-2-ethoxy-3-[4-[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]oxyphenyl]propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccc(O[C@@H](C)C(=O)OCc2ccccc2)cc1)OCC |
| InChI | InChI=1S/C23H28O6/c1-4-26-21(23(25)27-5-2)15-18-11-13-20(14-12-18)29-17(3)22(24)28-16-19-9-7-6-8-10-19/h6-14,17,21H,4-5,15-16H2,1-3H3/t17-,21+/m0/s1 |
| InChIKey | HJXBFCQFXRRUBB-LAUBAEHRSA-N |
| XLogP | 3.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |