C19H30O6S — CID 18625741
ethyl 2-methyl-2-[[4-(2-methylsulfonyloxyethoxy)phenyl]methyl]hexanoate (PubChem CID 18625741) has the molecular formula C19H30O6S and a molecular weight of 386.51 g/mol. Its IUPAC name is ethyl 2-methyl-2-[[4-(2-methylsulfonyloxyethoxy)phenyl]methyl]hexanoate.
| Compound Name | ethyl 2-methyl-2-[[4-(2-methylsulfonyloxyethoxy)phenyl]methyl]hexanoate |
|---|---|
| PubChem CID | 18625741 |
| Molecular Formula | C19H30O6S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | ethyl 2-methyl-2-[[4-(2-methylsulfonyloxyethoxy)phenyl]methyl]hexanoate |
| SMILES | CCCCC(C)(Cc1ccc(OCCOS(C)(=O)=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C19H30O6S/c1-5-7-12-19(3,18(20)23-6-2)15-16-8-10-17(11-9-16)24-13-14-25-26(4,21)22/h8-11H,5-7,12-15H2,1-4H3 |
| InChIKey | BNNXDOLXKOPUSD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|