C20H25NO5 — CID 121370835
ethyl (2S)-2-ethoxy-3-[4-[[4-(hydroxymethyl)-2-pyridinyl]methoxy]phenyl]propanoate (PubChem CID 121370835) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is ethyl (2S)-2-ethoxy-3-[4-[[4-(hydroxymethyl)-2-pyridinyl]methoxy]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-ethoxy-3-[4-[[4-(hydroxymethyl)-2-pyridinyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 121370835 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | ethyl (2S)-2-ethoxy-3-[4-[[4-(hydroxymethyl)-2-pyridinyl]methoxy]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCc2cc(CO)ccn2)cc1)OCC |
| InChI | InChI=1S/C20H25NO5/c1-3-24-19(20(23)25-4-2)12-15-5-7-18(8-6-15)26-14-17-11-16(13-22)9-10-21-17/h5-11,19,22H,3-4,12-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | HYROCCBFHKFDMN-IBGZPJMESA-N |
| XLogP | 2.66 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |