C18H19ClO3 — CID 133245203
2-(4-chloro-3-methylphenoxy)-3-(3,5-dimethylphenyl)propanoic acid (PubChem CID 133245203) has the molecular formula C18H19ClO3 and a molecular weight of 318.80 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-3-(3,5-dimethylphenyl)propanoic acid.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-3-(3,5-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 133245203 |
| Molecular Formula | C18H19ClO3 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-3-(3,5-dimethylphenyl)propanoic acid |
| SMILES | Cc1cc(C)cc(CC(Oc2ccc(Cl)c(C)c2)C(=O)O)c1 |
| InChI | InChI=1S/C18H19ClO3/c1-11-6-12(2)8-14(7-11)10-17(18(20)21)22-15-4-5-16(19)13(3)9-15/h4-9,17H,10H2,1-3H3,(H,20,21) |
| InChIKey | IABQKUOSSRWPAG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |