C17H16Cl2O4 — CID 100547805
(2S)-3-(3-chloro-4-methoxyphenyl)-2-(4-chloro-3-methylphenoxy)propanoic acid (PubChem CID 100547805) has the molecular formula C17H16Cl2O4 and a molecular weight of 355.22 g/mol. Its IUPAC name is (2S)-3-(3-chloro-4-methoxyphenyl)-2-(4-chloro-3-methylphenoxy)propanoic acid.
| Compound Name | (2S)-3-(3-chloro-4-methoxyphenyl)-2-(4-chloro-3-methylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100547805 |
| Molecular Formula | C17H16Cl2O4 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | (2S)-3-(3-chloro-4-methoxyphenyl)-2-(4-chloro-3-methylphenoxy)propanoic acid |
| SMILES | COc1ccc(C[C@H](Oc2ccc(Cl)c(C)c2)C(=O)O)cc1Cl |
| InChI | InChI=1S/C17H16Cl2O4/c1-10-7-12(4-5-13(10)18)23-16(17(20)21)9-11-3-6-15(22-2)14(19)8-11/h3-8,16H,9H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | NVWAXIQVTCTPAM-INIZCTEOSA-N |
| XLogP | 4.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |