C20H17ClO3 — CID 133245510
3-(4-chloro-2-methylphenyl)-2-naphthalen-2-yloxypropanoic acid (PubChem CID 133245510) has the molecular formula C20H17ClO3 and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-(4-chloro-2-methylphenyl)-2-naphthalen-2-yloxypropanoic acid.
| Compound Name | 3-(4-chloro-2-methylphenyl)-2-naphthalen-2-yloxypropanoic acid |
|---|---|
| PubChem CID | 133245510 |
| Molecular Formula | C20H17ClO3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 3-(4-chloro-2-methylphenyl)-2-naphthalen-2-yloxypropanoic acid |
| SMILES | Cc1cc(Cl)ccc1CC(Oc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C20H17ClO3/c1-13-10-17(21)8-6-15(13)12-19(20(22)23)24-18-9-7-14-4-2-3-5-16(14)11-18/h2-11,19H,12H2,1H3,(H,22,23) |
| InChIKey | ZMZMVZROKIQSGY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |