C22H27ClO5S — CID 67908028
2-(4-tert-butylphenoxy)-6-(4-chlorophenyl)sulfonylhexanoic acid (PubChem CID 67908028) has the molecular formula C22H27ClO5S and a molecular weight of 438.97 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-6-(4-chlorophenyl)sulfonylhexanoic acid.
| Compound Name | 2-(4-tert-butylphenoxy)-6-(4-chlorophenyl)sulfonylhexanoic acid |
|---|---|
| PubChem CID | 67908028 |
| Molecular Formula | C22H27ClO5S |
| Molecular Weight | 438.97 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-6-(4-chlorophenyl)sulfonylhexanoic acid |
| SMILES | CC(C)(C)c1ccc(OC(CCCCS(=O)(=O)c2ccc(Cl)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H27ClO5S/c1-22(2,3)16-7-11-18(12-8-16)28-20(21(24)25)6-4-5-15-29(26,27)19-13-9-17(23)10-14-19/h7-14,20H,4-6,15H2,1-3H3,(H,24,25) |
| InChIKey | PVRYCPVBLLTKEW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.97 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|