C15H23BF3KO — CID 63703366
potassium trifluoro-[[4-(2,4,4-trimethylpentan-2-yl)phenoxy]methyl]boranuide (PubChem CID 63703366) has the molecular formula C15H23BF3KO and a molecular weight of 326.25 g/mol. Its IUPAC name is potassium trifluoro-[[4-(2,4,4-trimethylpentan-2-yl)phenoxy]methyl]boranuide.
| Compound Name | potassium trifluoro-[[4-(2,4,4-trimethylpentan-2-yl)phenoxy]methyl]boranuide |
|---|---|
| PubChem CID | 63703366 |
| Molecular Formula | C15H23BF3KO |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | potassium trifluoro-[[4-(2,4,4-trimethylpentan-2-yl)phenoxy]methyl]boranuide |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OC[B-](F)(F)F)cc1.[K+] |
| InChI | InChI=1S/C15H23BF3O.K/c1-14(2,3)10-15(4,5)12-6-8-13(9-7-12)20-11-16(17,18)19;/h6-9H,10-11H2,1-5H3;/q-1;+1 |
| InChIKey | PNVGZPVXBAFAAL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|