C11H11F3O4 — CID 84738454
4,4,4-trifluoro-3-(4-hydroxyphenyl)-3-methoxybutanoic acid (PubChem CID 84738454) has the molecular formula C11H11F3O4 and a molecular weight of 264.20 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(4-hydroxyphenyl)-3-methoxybutanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(4-hydroxyphenyl)-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 84738454 |
| Molecular Formula | C11H11F3O4 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 4,4,4-trifluoro-3-(4-hydroxyphenyl)-3-methoxybutanoic acid |
| SMILES | COC(CC(=O)O)(c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O4/c1-18-10(6-9(16)17,11(12,13)14)7-2-4-8(15)5-3-7/h2-5,15H,6H2,1H3,(H,16,17) |
| InChIKey | NJNIVLAVGMGMNC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |