C20H18O10 — CID 139878478
2,3-bis(4-hydroxyphenyl)butane-1,2,3,4-tetracarboxylic acid (PubChem CID 139878478) has the molecular formula C20H18O10 and a molecular weight of 418.35 g/mol. Its IUPAC name is 2,3-bis(4-hydroxyphenyl)butane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 2,3-bis(4-hydroxyphenyl)butane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 139878478 |
| Molecular Formula | C20H18O10 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2,3-bis(4-hydroxyphenyl)butane-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)CC(C(=O)O)(c1ccc(O)cc1)C(CC(=O)O)(C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H18O10/c21-13-5-1-11(2-6-13)19(17(27)28,9-15(23)24)20(18(29)30,10-16(25)26)12-3-7-14(22)8-4-12/h1-8,21-22H,9-10H2,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | BZKGGBVKGMMBJF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |