C17H14Cl2O3 — CID 17464453
(2-naphthalen-2-yl-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 17464453) has the molecular formula C17H14Cl2O3 and a molecular weight of 337.20 g/mol. Its IUPAC name is (2-naphthalen-2-yl-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | (2-naphthalen-2-yl-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 17464453 |
| Molecular Formula | C17H14Cl2O3 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | (2-naphthalen-2-yl-2-oxoethyl) 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCC(=O)c2ccc3ccccc3c2)CC1(Cl)Cl |
| InChI | InChI=1S/C17H14Cl2O3/c1-16(10-17(16,18)19)15(21)22-9-14(20)13-7-6-11-4-2-3-5-12(11)8-13/h2-8H,9-10H2,1H3 |
| InChIKey | QAGUSRBIQUJFMG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|