C21H21FO4 — CID 8661519
[2-(4-methoxyphenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 8661519) has the molecular formula C21H21FO4 and a molecular weight of 356.39 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 8661519 |
| Molecular Formula | C21H21FO4 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)C2(c3ccccc3F)CCCC2)cc1 |
| InChI | InChI=1S/C21H21FO4/c1-25-16-10-8-15(9-11-16)19(23)14-26-20(24)21(12-4-5-13-21)17-6-2-3-7-18(17)22/h2-3,6-11H,4-5,12-14H2,1H3 |
| InChIKey | LZQYNOLIQZBKTP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |