C19H24FNO3 — CID 8661548
[2-(cyclopentylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 8661548) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 8661548 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2F)CCCC1)NC1CCCC1 |
| InChI | InChI=1S/C19H24FNO3/c20-16-10-4-3-9-15(16)19(11-5-6-12-19)18(23)24-13-17(22)21-14-7-1-2-8-14/h3-4,9-10,14H,1-2,5-8,11-13H2,(H,21,22) |
| InChIKey | FJQDDPKGLMQZMB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |