C20H19FINO3 — CID 2353380
[2-(4-iodoanilino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 2353380) has the molecular formula C20H19FINO3 and a molecular weight of 467.28 g/mol. Its IUPAC name is [2-(4-iodoanilino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(4-iodoanilino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 2353380 |
| Molecular Formula | C20H19FINO3 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | [2-(4-iodoanilino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2F)CCCC1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C20H19FINO3/c21-17-6-2-1-5-16(17)20(11-3-4-12-20)19(25)26-13-18(24)23-15-9-7-14(22)8-10-15/h1-2,5-10H,3-4,11-13H2,(H,23,24) |
| InChIKey | XPNFHMTVZSMEFG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|