C21H28FNO3 — CID 23932612
[2-(cycloheptylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 23932612) has the molecular formula C21H28FNO3 and a molecular weight of 361.46 g/mol. Its IUPAC name is [2-(cycloheptylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(cycloheptylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 23932612 |
| Molecular Formula | C21H28FNO3 |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | [2-(cycloheptylamino)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2F)CCCC1)NC1CCCCCC1 |
| InChI | InChI=1S/C21H28FNO3/c22-18-12-6-5-11-17(18)21(13-7-8-14-21)20(25)26-15-19(24)23-16-9-3-1-2-4-10-16/h5-6,11-12,16H,1-4,7-10,13-15H2,(H,23,24) |
| InChIKey | XACDTUVRVRDFTI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |