C20H18BrFO3 — CID 23853345
[2-(2-bromophenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate (PubChem CID 23853345) has the molecular formula C20H18BrFO3 and a molecular weight of 405.26 g/mol. Its IUPAC name is [2-(2-bromophenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate.
| Compound Name | [2-(2-bromophenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 23853345 |
| Molecular Formula | C20H18BrFO3 |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | [2-(2-bromophenyl)-2-oxoethyl] 1-(2-fluorophenyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(c2ccccc2F)CCCC1)c1ccccc1Br |
| InChI | InChI=1S/C20H18BrFO3/c21-16-9-3-1-7-14(16)18(23)13-25-19(24)20(11-5-6-12-20)15-8-2-4-10-17(15)22/h1-4,7-10H,5-6,11-13H2 |
| InChIKey | TYWSVHKHGIYKTD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |