About [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate
[2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 1218644) has the molecular formula C15H14O3S
and a molecular weight of 274.34 g/mol. Its IUPAC name is [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate.
Analyze [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate?
The IUPAC name of [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate (CID 1218644) is [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate.
What is the SMILES notation for [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate?
The canonical SMILES for [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate is Cc1ccc(C(=O)COC(=O)c2cccs2)cc1C.
What is the InChIKey of [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate?
The InChIKey is RSXBXQKYBQISRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O3S/c1-10-5-6-12(8-11(10)2)13(16)9-18-15(17)14-4-3-7-19-14/h3-8H,9H2,1-2H3.
What are the key properties of [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate?
[2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate has a molecular weight of 274.34 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(3,4-dimethylphenyl)-2-oxoethyl] thiophene-2-carboxylate is sourced from PubChem (CID 1218644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).