About [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate
[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 31117221) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate.
Molecular Properties
| Compound Name | [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate |
| PubChem CID | 31117221 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cccs2)c(C)[nH]1 |
| InChI | InChI=1S/C13H13NO3S/c1-8-6-10(9(2)14-8)11(15)7-17-13(16)12-4-3-5-18-12/h3-6,14H,7H2,1-2H3 |
| InChIKey | HJLMDTIRMVAQRH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate?
The IUPAC name of [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate (CID 31117221) is [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate.
What is the SMILES notation for [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate?
The canonical SMILES for [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate is Cc1cc(C(=O)COC(=O)c2cccs2)c(C)[nH]1.
What is the InChIKey of [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate?
The InChIKey is HJLMDTIRMVAQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-8-6-10(9(2)14-8)11(15)7-17-13(16)12-4-3-5-18-12/h3-6,14H,7H2,1-2H3.
What are the key properties of [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate?
[2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate has a molecular weight of 263.32 g/mol, XLogP of 2.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethyl-1H-pyrrol-3-yl)-2-oxoethyl] thiophene-2-carboxylate is sourced from PubChem (CID 31117221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).