C25H37ClN2O — CID 119596106
[3-(1-aminoethyl)piperidin-1-yl]-[3-(4-methylphenyl)-1-adamantyl]methanone;hydrochloride (PubChem CID 119596106) has the molecular formula C25H37ClN2O and a molecular weight of 417.04 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-[3-(4-methylphenyl)-1-adamantyl]methanone;hydrochloride.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-[3-(4-methylphenyl)-1-adamantyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119596106 |
| Molecular Formula | C25H37ClN2O |
| Molecular Weight | 417.04 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-[3-(4-methylphenyl)-1-adamantyl]methanone;hydrochloride |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)N5CCCC(C(C)N)C5)(C4)C2)C3)cc1.Cl |
| InChI | InChI=1S/C25H36N2O.ClH/c1-17-5-7-22(8-6-17)24-11-19-10-20(12-24)14-25(13-19,16-24)23(28)27-9-3-4-21(15-27)18(2)26;/h5-8,18-21H,3-4,9-16,26H2,1-2H3;1H |
| InChIKey | PQBJCKFAPOWTCY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.04 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |