C23H30N2O3 — CID 98512410
1-[(5R,7R)-3-hydroxyadamantane-1-carbonyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 98512410) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-[(5R,7R)-3-hydroxyadamantane-1-carbonyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[(5R,7R)-3-hydroxyadamantane-1-carbonyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 98512410 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-[(5R,7R)-3-hydroxyadamantane-1-carbonyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)C23C[C@H]4C[C@@H](CC(O)(C4)C2)C3)CC1 |
| InChI | InChI=1S/C23H30N2O3/c26-20(24-19-4-2-1-3-5-19)18-6-8-25(9-7-18)21(27)22-11-16-10-17(12-22)14-23(28,13-16)15-22/h1-5,16-18,28H,6-15H2,(H,24,26)/t16-,17-,22?,23?/m1/s1 |
| InChIKey | SUNMHLLCAXAPGL-TWVWUCKLSA-N |
| XLogP | 3.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |