C21H28N2O3 — CID 51589067
[(5S,7R)-3-hydroxy-1-adamantyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone (PubChem CID 51589067) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is [(5S,7R)-3-hydroxy-1-adamantyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone.
| Compound Name | [(5S,7R)-3-hydroxy-1-adamantyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 51589067 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | [(5S,7R)-3-hydroxy-1-adamantyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone |
| SMILES | O=C(N1CCC(Oc2cccnc2)CC1)C12C[C@@H]3C[C@@H](CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C21H28N2O3/c24-19(20-9-15-8-16(10-20)12-21(25,11-15)14-20)23-6-3-17(4-7-23)26-18-2-1-5-22-13-18/h1-2,5,13,15-17,25H,3-4,6-12,14H2/t15-,16+,20?,21? |
| InChIKey | FVHASJNBGWOBOA-XBLGPDGASA-N |
| XLogP | 2.78 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |