C20H22N2O2 — CID 56643265
[(1R,2R)-2-phenylcyclopropyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone (PubChem CID 56643265) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is [(1R,2R)-2-phenylcyclopropyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone.
| Compound Name | [(1R,2R)-2-phenylcyclopropyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56643265 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | [(1R,2R)-2-phenylcyclopropyl]-(4-pyridin-3-yloxypiperidin-1-yl)methanone |
| SMILES | O=C([C@@H]1C[C@H]1c1ccccc1)N1CCC(Oc2cccnc2)CC1 |
| InChI | InChI=1S/C20H22N2O2/c23-20(19-13-18(19)15-5-2-1-3-6-15)22-11-8-16(9-12-22)24-17-7-4-10-21-14-17/h1-7,10,14,16,18-19H,8-9,11-13H2/t18-,19+/m0/s1 |
| InChIKey | AOIFUEUGIZLZTJ-RBUKOAKNSA-N |
| XLogP | 3.26 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |