C26H25ClF3NO3 — CID 3374560
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenyladamantane-1-carboxylate (PubChem CID 3374560) has the molecular formula C26H25ClF3NO3 and a molecular weight of 491.94 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenyladamantane-1-carboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 3374560 |
| Molecular Formula | C26H25ClF3NO3 |
| Molecular Weight | 491.94 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenyladamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(C1)CC(c1ccccc1)(C3)C2)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C26H25ClF3NO3/c27-19-6-7-21(20(9-19)26(28,29)30)31-22(32)14-34-23(33)25-12-16-8-17(13-25)11-24(10-16,15-25)18-4-2-1-3-5-18/h1-7,9,16-17H,8,10-15H2,(H,31,32) |
| InChIKey | BSRXGHGOEBESSR-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.94 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |