C25H31N3O — CID 166232511
[3-(3,4-dimethylphenyl)-1-adamantyl]-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone (PubChem CID 166232511) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-1-adamantyl]-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone.
| Compound Name | [3-(3,4-dimethylphenyl)-1-adamantyl]-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 166232511 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-1-adamantyl]-(1,4,5,7-tetrahydropyrazolo[5,4-c]pyridin-6-yl)methanone |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)N5CCc6cn[nH]c6C5)(C4)C2)C3)cc1C |
| InChI | InChI=1S/C25H31N3O/c1-16-3-4-21(7-17(16)2)24-9-18-8-19(10-24)12-25(11-18,15-24)23(29)28-6-5-20-13-26-27-22(20)14-28/h3-4,7,13,18-19H,5-6,8-12,14-15H2,1-2H3,(H,26,27) |
| InChIKey | SGQJRDMCCYRWNM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |