C26H27F4NO2 — CID 27787859
(5S,7R)-3-(4-methylphenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]adamantane-1-carboxamide (PubChem CID 27787859) has the molecular formula C26H27F4NO2 and a molecular weight of 461.50 g/mol. Its IUPAC name is (5S,7R)-3-(4-methylphenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-(4-methylphenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 27787859 |
| Molecular Formula | C26H27F4NO2 |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | (5S,7R)-3-(4-methylphenyl)-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)Nc5cccc(OC(F)(F)C(F)F)c5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H27F4NO2/c1-16-5-7-19(8-6-16)24-11-17-9-18(12-24)14-25(13-17,15-24)23(32)31-20-3-2-4-21(10-20)33-26(29,30)22(27)28/h2-8,10,17-18,22H,9,11-15H2,1H3,(H,31,32)/t17-,18+,24?,25? |
| InChIKey | AZEAILSWHNGOKA-FLCJAFJVSA-N |
| XLogP | 6.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|