C28H36N2O3S — CID 26857417
(5S,7R)-N-[3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)adamantane-1-carboxamide (PubChem CID 26857417) has the molecular formula C28H36N2O3S and a molecular weight of 480.67 g/mol. Its IUPAC name is (5S,7R)-N-[3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)adamantane-1-carboxamide.
| Compound Name | (5S,7R)-N-[3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 26857417 |
| Molecular Formula | C28H36N2O3S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | (5S,7R)-N-[3-(diethylsulfamoyl)phenyl]-3-(4-methylphenyl)adamantane-1-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(NC(=O)C23C[C@H]4C[C@@H](C2)CC(c2ccc(C)cc2)(C4)C3)c1 |
| InChI | InChI=1S/C28H36N2O3S/c1-4-30(5-2)34(32,33)25-8-6-7-24(14-25)29-26(31)28-17-21-13-22(18-28)16-27(15-21,19-28)23-11-9-20(3)10-12-23/h6-12,14,21-22H,4-5,13,15-19H2,1-3H3,(H,29,31)/t21-,22+,27?,28? |
| InChIKey | CAHOWNPGUUDXQL-LDCALFFHSA-N |
| XLogP | 5.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |