C31H37N3O3S2 — CID 3268194
4-(diethylsulfamoyl)-N-[4-[3-(4-methylphenyl)-1-adamantyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 3268194) has the molecular formula C31H37N3O3S2 and a molecular weight of 563.79 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[4-[3-(4-methylphenyl)-1-adamantyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[4-[3-(4-methylphenyl)-1-adamantyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3268194 |
| Molecular Formula | C31H37N3O3S2 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[4-[3-(4-methylphenyl)-1-adamantyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nc(C34CC5CC(CC(c6ccc(C)cc6)(C5)C3)C4)cs2)cc1 |
| InChI | InChI=1S/C31H37N3O3S2/c1-4-34(5-2)39(36,37)26-12-8-24(9-13-26)28(35)33-29-32-27(19-38-29)31-17-22-14-23(18-31)16-30(15-22,20-31)25-10-6-21(3)7-11-25/h6-13,19,22-23H,4-5,14-18,20H2,1-3H3,(H,32,33,35) |
| InChIKey | YBVVTYRTNUHKOF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |