C26H28N4O3S2 — CID 100563723
N-[5-[[4-(1-adamantyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide (PubChem CID 100563723) has the molecular formula C26H28N4O3S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-[5-[[4-(1-adamantyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide.
| Compound Name | N-[5-[[4-(1-adamantyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 100563723 |
| Molecular Formula | C26H28N4O3S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N-[5-[[4-(1-adamantyl)phenyl]sulfamoyl]-1,3,4-thiadiazol-2-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2nnc(S(=O)(=O)Nc3ccc(C45CC6CC(CC(C6)C4)C5)cc3)s2)cc1 |
| InChI | InChI=1S/C26H28N4O3S2/c1-16-2-4-20(5-3-16)23(31)27-24-28-29-25(34-24)35(32,33)30-22-8-6-21(7-9-22)26-13-17-10-18(14-26)12-19(11-17)15-26/h2-9,17-19,30H,10-15H2,1H3,(H,27,28,31) |
| InChIKey | OCKFOWNMIHDCEP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|