C19H18F3NO2 — CID 55742350
N-[3-(difluoromethoxy)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide (PubChem CID 55742350) has the molecular formula C19H18F3NO2 and a molecular weight of 349.35 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55742350 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-1-(3-fluorophenyl)cyclopentane-1-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)C1(c2cccc(F)c2)CCCC1 |
| InChI | InChI=1S/C19H18F3NO2/c20-14-6-3-5-13(11-14)19(9-1-2-10-19)17(24)23-15-7-4-8-16(12-15)25-18(21)22/h3-8,11-12,18H,1-2,9-10H2,(H,23,24) |
| InChIKey | UZJLZZSZJDBCQT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |