C12H13F2NO3S — CID 97251599
(3S)-N-[4-(difluoromethoxy)phenyl]-3-hydroxythiolane-3-carboxamide (PubChem CID 97251599) has the molecular formula C12H13F2NO3S and a molecular weight of 289.30 g/mol. Its IUPAC name is (3S)-N-[4-(difluoromethoxy)phenyl]-3-hydroxythiolane-3-carboxamide.
| Compound Name | (3S)-N-[4-(difluoromethoxy)phenyl]-3-hydroxythiolane-3-carboxamide |
|---|---|
| PubChem CID | 97251599 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (3S)-N-[4-(difluoromethoxy)phenyl]-3-hydroxythiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)[C@@]1(O)CCSC1 |
| InChI | InChI=1S/C12H13F2NO3S/c13-11(14)18-9-3-1-8(2-4-9)15-10(16)12(17)5-6-19-7-12/h1-4,11,17H,5-7H2,(H,15,16)/t12-/m1/s1 |
| InChIKey | OOBYHLCVVRZJJG-GFCCVEGCSA-N |
| XLogP | 2.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |