C19H22N4O4 — CID 8549513
3-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]acetyl]amino]-N-methylbenzamide (PubChem CID 8549513) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]acetyl]amino]-N-methylbenzamide.
| Compound Name | 3-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 8549513 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[[2-[4-(furan-2-carbonyl)piperazin-1-yl]acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)CN2CCN(C(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C19H22N4O4/c1-20-18(25)14-4-2-5-15(12-14)21-17(24)13-22-7-9-23(10-8-22)19(26)16-6-3-11-27-16/h2-6,11-12H,7-10,13H2,1H3,(H,20,25)(H,21,24) |
| InChIKey | DLIHKEFLQXHDGP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |