C17H16Cl2N2O3 — CID 42938602
N-(2,3-dichlorophenyl)-1-(furan-2-carbonyl)piperidine-3-carboxamide (PubChem CID 42938602) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-1-(furan-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(2,3-dichlorophenyl)-1-(furan-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42938602 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-1-(furan-2-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)C1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C17H16Cl2N2O3/c18-12-5-1-6-13(15(12)19)20-16(22)11-4-2-8-21(10-11)17(23)14-7-3-9-24-14/h1,3,5-7,9,11H,2,4,8,10H2,(H,20,22) |
| InChIKey | IPDWDWMOJHFLOY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |