C18H17Cl2N3O4 — CID 46520147
N'-(2,5-dichlorobenzoyl)-1-(furan-2-carbonyl)piperidine-3-carbohydrazide (PubChem CID 46520147) has the molecular formula C18H17Cl2N3O4 and a molecular weight of 410.26 g/mol. Its IUPAC name is N'-(2,5-dichlorobenzoyl)-1-(furan-2-carbonyl)piperidine-3-carbohydrazide.
| Compound Name | N'-(2,5-dichlorobenzoyl)-1-(furan-2-carbonyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 46520147 |
| Molecular Formula | C18H17Cl2N3O4 |
| Molecular Weight | 410.26 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | N'-(2,5-dichlorobenzoyl)-1-(furan-2-carbonyl)piperidine-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCCN(C(=O)c2ccco2)C1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O4/c19-12-5-6-14(20)13(9-12)17(25)22-21-16(24)11-3-1-7-23(10-11)18(26)15-4-2-8-27-15/h2,4-6,8-9,11H,1,3,7,10H2,(H,21,24)(H,22,25) |
| InChIKey | YZWPLLFGYAXUSH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|