C20H24N4O4 — CID 35824611
(3S)-N'-[3-(dimethylamino)benzoyl]-1-(furan-2-carbonyl)piperidine-3-carbohydrazide (PubChem CID 35824611) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is (3S)-N'-[3-(dimethylamino)benzoyl]-1-(furan-2-carbonyl)piperidine-3-carbohydrazide.
| Compound Name | (3S)-N'-[3-(dimethylamino)benzoyl]-1-(furan-2-carbonyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 35824611 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3S)-N'-[3-(dimethylamino)benzoyl]-1-(furan-2-carbonyl)piperidine-3-carbohydrazide |
| SMILES | CN(C)c1cccc(C(=O)NNC(=O)[C@H]2CCCN(C(=O)c3ccco3)C2)c1 |
| InChI | InChI=1S/C20H24N4O4/c1-23(2)16-8-3-6-14(12-16)18(25)21-22-19(26)15-7-4-10-24(13-15)20(27)17-9-5-11-28-17/h3,5-6,8-9,11-12,15H,4,7,10,13H2,1-2H3,(H,21,25)(H,22,26)/t15-/m0/s1 |
| InChIKey | XDPVSKBGFASTPJ-HNNXBMFYSA-N |
| XLogP | 1.66 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|