C21H27N3O3S2 — CID 39927268
N-[2-(3,4-dimethylphenyl)sulfanylethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide (PubChem CID 39927268) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)sulfanylethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(3,4-dimethylphenyl)sulfanylethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 39927268 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)sulfanylethyl]-1-pyridin-3-ylsulfonylpiperidine-4-carboxamide |
| SMILES | Cc1ccc(SCCNC(=O)C2CCN(S(=O)(=O)c3cccnc3)CC2)cc1C |
| InChI | InChI=1S/C21H27N3O3S2/c1-16-5-6-19(14-17(16)2)28-13-10-23-21(25)18-7-11-24(12-8-18)29(26,27)20-4-3-9-22-15-20/h3-6,9,14-15,18H,7-8,10-13H2,1-2H3,(H,23,25) |
| InChIKey | FXTZVXWEHXZMSX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|