C18H22N4O3S2 — CID 34704038
N-(2-phenylsulfanylethyl)-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide (PubChem CID 34704038) has the molecular formula C18H22N4O3S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-(2-phenylsulfanylethyl)-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 34704038 |
| Molecular Formula | C18H22N4O3S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide |
| SMILES | O=C(NCCSc1ccccc1)N1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C18H22N4O3S2/c23-18(20-9-14-26-16-5-2-1-3-6-16)21-10-12-22(13-11-21)27(24,25)17-7-4-8-19-15-17/h1-8,15H,9-14H2,(H,20,23) |
| InChIKey | ZJLQJFGBEQOLBX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|