C17H20N4O4S2 — CID 95786560
N-[4-[(S)-methylsulfinyl]phenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide (PubChem CID 95786560) has the molecular formula C17H20N4O4S2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[4-[(S)-methylsulfinyl]phenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-[4-[(S)-methylsulfinyl]phenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 95786560 |
| Molecular Formula | C17H20N4O4S2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[4-[(S)-methylsulfinyl]phenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide |
| SMILES | C[S@](=O)c1ccc(NC(=O)N2CCN(S(=O)(=O)c3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C17H20N4O4S2/c1-26(23)15-6-4-14(5-7-15)19-17(22)20-9-11-21(12-10-20)27(24,25)16-3-2-8-18-13-16/h2-8,13H,9-12H2,1H3,(H,19,22)/t26-/m0/s1 |
| InChIKey | IYKAQBSVSNQRPF-SANMLTNESA-N |
| XLogP | 1.36 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |