C19H23N5O4S2 — CID 56586770
N-[2-(3-amino-3-oxopropyl)sulfanylphenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide (PubChem CID 56586770) has the molecular formula C19H23N5O4S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is N-[2-(3-amino-3-oxopropyl)sulfanylphenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-[2-(3-amino-3-oxopropyl)sulfanylphenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 56586770 |
| Molecular Formula | C19H23N5O4S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N-[2-(3-amino-3-oxopropyl)sulfanylphenyl]-4-pyridin-3-ylsulfonylpiperazine-1-carboxamide |
| SMILES | NC(=O)CCSc1ccccc1NC(=O)N1CCN(S(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C19H23N5O4S2/c20-18(25)7-13-29-17-6-2-1-5-16(17)22-19(26)23-9-11-24(12-10-23)30(27,28)15-4-3-8-21-14-15/h1-6,8,14H,7,9-13H2,(H2,20,25)(H,22,26) |
| InChIKey | VFIGIOJTENEXEH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |