C15H24N4O3S2 — CID 33384848
4-(dimethylsulfamoyl)-N-(2-phenylsulfanylethyl)piperazine-1-carboxamide (PubChem CID 33384848) has the molecular formula C15H24N4O3S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-(2-phenylsulfanylethyl)piperazine-1-carboxamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-(2-phenylsulfanylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 33384848 |
| Molecular Formula | C15H24N4O3S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-(2-phenylsulfanylethyl)piperazine-1-carboxamide |
| SMILES | CN(C)S(=O)(=O)N1CCN(C(=O)NCCSc2ccccc2)CC1 |
| InChI | InChI=1S/C15H24N4O3S2/c1-17(2)24(21,22)19-11-9-18(10-12-19)15(20)16-8-13-23-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3,(H,16,20) |
| InChIKey | CSGNYZJFCJSGSZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|