C21H29N5 — CID 56883222
4-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 56883222) has the molecular formula C21H29N5 and a molecular weight of 351.50 g/mol. Its IUPAC name is 4-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56883222 |
| Molecular Formula | C21H29N5 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 4-[4-[1-(2-phenylethyl)pyrrolidin-3-yl]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Nc1nccc(N2CCC(C3CCN(CCc4ccccc4)C3)CC2)n1 |
| InChI | InChI=1S/C21H29N5/c22-21-23-11-6-20(24-21)26-14-9-18(10-15-26)19-8-13-25(16-19)12-7-17-4-2-1-3-5-17/h1-6,11,18-19H,7-10,12-16H2,(H2,22,23,24) |
| InChIKey | LARPSEWLNNELGN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |