C21H29N3S — CID 155501199
2-[4-[1-(2-phenylethyl)piperidin-4-yl]piperidin-1-yl]-1,3-thiazole (PubChem CID 155501199) has the molecular formula C21H29N3S and a molecular weight of 355.55 g/mol. Its IUPAC name is 2-[4-[1-(2-phenylethyl)piperidin-4-yl]piperidin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[1-(2-phenylethyl)piperidin-4-yl]piperidin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155501199 |
| Molecular Formula | C21H29N3S |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 2-[4-[1-(2-phenylethyl)piperidin-4-yl]piperidin-1-yl]-1,3-thiazole |
| SMILES | c1ccc(CCN2CCC(C3CCN(c4nccs4)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3S/c1-2-4-18(5-3-1)6-12-23-13-7-19(8-14-23)20-9-15-24(16-10-20)21-22-11-17-25-21/h1-5,11,17,19-20H,6-10,12-16H2 |
| InChIKey | WACJQOFJMHYGFA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |