C16H21N3S — CID 61283477
1-(2-phenylethyl)-N-(1,3-thiazol-2-ylmethyl)pyrrolidin-3-amine (PubChem CID 61283477) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 1-(2-phenylethyl)-N-(1,3-thiazol-2-ylmethyl)pyrrolidin-3-amine.
| Compound Name | 1-(2-phenylethyl)-N-(1,3-thiazol-2-ylmethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 61283477 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(2-phenylethyl)-N-(1,3-thiazol-2-ylmethyl)pyrrolidin-3-amine |
| SMILES | c1ccc(CCN2CCC(NCc3nccs3)C2)cc1 |
| InChI | InChI=1S/C16H21N3S/c1-2-4-14(5-3-1)6-9-19-10-7-15(13-19)18-12-16-17-8-11-20-16/h1-5,8,11,15,18H,6-7,9-10,12-13H2 |
| InChIKey | DNZFNOLFALGXFM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |