C17H21BrN2S — CID 79692331
N-[(3-bromothiophen-2-yl)methyl]-1-(2-phenylethyl)pyrrolidin-3-amine (PubChem CID 79692331) has the molecular formula C17H21BrN2S and a molecular weight of 365.34 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-1-(2-phenylethyl)pyrrolidin-3-amine.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-1-(2-phenylethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 79692331 |
| Molecular Formula | C17H21BrN2S |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-1-(2-phenylethyl)pyrrolidin-3-amine |
| SMILES | Brc1ccsc1CNC1CCN(CCc2ccccc2)C1 |
| InChI | InChI=1S/C17H21BrN2S/c18-16-8-11-21-17(16)12-19-15-7-10-20(13-15)9-6-14-4-2-1-3-5-14/h1-5,8,11,15,19H,6-7,9-10,12-13H2 |
| InChIKey | UTESTWIVTHKLCY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |