C18H23N3OS — CID 90597351
4-phenyl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butanamide (PubChem CID 90597351) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is 4-phenyl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butanamide.
| Compound Name | 4-phenyl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butanamide |
|---|---|
| PubChem CID | 90597351 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-phenyl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]butanamide |
| SMILES | O=C(CCCc1ccccc1)NC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C18H23N3OS/c22-17(8-4-7-15-5-2-1-3-6-15)20-16-9-12-21(13-10-16)18-19-11-14-23-18/h1-3,5-6,11,14,16H,4,7-10,12-13H2,(H,20,22) |
| InChIKey | IANUYBKESMGMAC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |