C17H21N3O2S — CID 90597199
2-(2-methylphenoxy)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]acetamide (PubChem CID 90597199) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 2-(2-methylphenoxy)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]acetamide.
| Compound Name | 2-(2-methylphenoxy)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 90597199 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(2-methylphenoxy)-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]acetamide |
| SMILES | Cc1ccccc1OCC(=O)NC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H21N3O2S/c1-13-4-2-3-5-15(13)22-12-16(21)19-14-6-9-20(10-7-14)17-18-8-11-23-17/h2-5,8,11,14H,6-7,9-10,12H2,1H3,(H,19,21) |
| InChIKey | AQZLWNQRGCOKTA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |