C20H26N4O — CID 47047200
4-(4-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanamide (PubChem CID 47047200) has the molecular formula C20H26N4O and a molecular weight of 338.45 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanamide.
| Compound Name | 4-(4-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 47047200 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 4-(4-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)butanamide |
| SMILES | Cc1ccc(CCCC(=O)NC2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C20H26N4O/c1-16-6-8-17(9-7-16)4-2-5-19(25)23-18-10-14-24(15-11-18)20-21-12-3-13-22-20/h3,6-9,12-13,18H,2,4-5,10-11,14-15H2,1H3,(H,23,25) |
| InChIKey | JQZRTSIDGCKBNK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |