C18H22N4O — CID 110712574
2-(3-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide (PubChem CID 110712574) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide.
| Compound Name | 2-(3-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 110712574 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-(3-methylphenyl)-N-(1-pyrimidin-2-ylpiperidin-4-yl)acetamide |
| SMILES | Cc1cccc(CC(=O)NC2CCN(c3ncccn3)CC2)c1 |
| InChI | InChI=1S/C18H22N4O/c1-14-4-2-5-15(12-14)13-17(23)21-16-6-10-22(11-7-16)18-19-8-3-9-20-18/h2-5,8-9,12,16H,6-7,10-11,13H2,1H3,(H,21,23) |
| InChIKey | QXQKGHCYRUVEGI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |