1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid

C10H17NO5 — CID 112568235

IUPAC1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CCN(CCCO)CC1C(=O)O
InChIInChI=1S/C10H17NO5/c12-5-1-3-11-4-2-7(9(13)14)8(6-11)10(15)16/h7-8,12H,1-6H2,(H,13,14)(H,15,16)
InChIKeyAUBMUOVLTRWQMH-UHFFFAOYSA-N
MW231.25 g/mol
LogP-0.52
Rot. Bonds5

About 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid

1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid (PubChem CID 112568235) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid.

Molecular Properties

Compound Name1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid
PubChem CID112568235
Molecular FormulaC10H17NO5
Molecular Weight231.25 g/mol
Exact Mass231.11
IUPAC Name1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid
SMILESO=C(O)C1CCN(CCCO)CC1C(=O)O
InChIInChI=1S/C10H17NO5/c12-5-1-3-11-4-2-7(9(13)14)8(6-11)10(15)16/h7-8,12H,1-6H2,(H,13,14)(H,15,16)
InChIKeyAUBMUOVLTRWQMH-UHFFFAOYSA-N
XLogP-0.52
TPSA98.07 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 5-0.52
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid?
The IUPAC name of 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid (CID 112568235) is 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid.
What is the SMILES notation for 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid?
The canonical SMILES for 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid is O=C(O)C1CCN(CCCO)CC1C(=O)O.
What is the InChIKey of 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid?
The InChIKey is AUBMUOVLTRWQMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5/c12-5-1-3-11-4-2-7(9(13)14)8(6-11)10(15)16/h7-8,12H,1-6H2,(H,13,14)(H,15,16).
What are the key properties of 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid?
1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid has a molecular weight of 231.25 g/mol, XLogP of -0.52, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-hydroxypropyl)piperidine-3,4-dicarboxylic acid is sourced from PubChem (CID 112568235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).